![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | System Design - The Big Archive.pdf | 2023-08-09 19:40 | 38M | |
![[VID]](/icons/movie.gif) | System Design Was HARD - Until You Knew the Trade-Offs.mp4 | 2025-04-29 05:38 | 15M | |
![[ ]](/icons/unknown.gif) | Thumbs.db | 2026-01-16 10:25 | 2.5M | |
![[IMG]](/icons/image2.gif) | 18 Key Design Patterns Every Developer Should Know.gif | 2025-04-14 06:17 | 2.0M | |
![[IMG]](/icons/image2.gif) | Must-Know Network Protocol Dependencies.gif | 2025-04-14 06:16 | 1.9M | |
![[IMG]](/icons/image2.gif) | How to Learn API Development.gif | 2025-04-14 06:16 | 1.7M | |
![[IMG]](/icons/image2.gif) | Big Data Pipeline Cheatsheet for AWS, Azure, and Google Cloud.gif | 2024-10-27 13:33 | 1.7M | |
![[IMG]](/icons/image2.gif) | What is an AI Agent.gif | 2025-04-29 05:35 | 1.4M | |
![[IMG]](/icons/image2.gif) | A Cheatsheet to Build Secure APIs.gif | 2024-10-27 13:34 | 1.1M | |
![[IMG]](/icons/image2.gif) | How SSO Works.jpg | 2025-04-24 05:36 | 1.0M | |
![[IMG]](/icons/image2.gif) | Databases.jpg | 2025-02-10 08:06 | 1.0M | |
![[IMG]](/icons/image2.gif) | How PostgreSQL Works.gif | 2025-02-17 07:25 | 1.0M | |
![[IMG]](/icons/image2.gif) | Big O Notation 101.jpg | 2025-02-10 08:04 | 951K | |
![[IMG]](/icons/image2.gif) | 9 OOP Design Patterns You Must Know.gif | 2025-04-29 05:36 | 848K | |
![[IMG]](/icons/image2.gif) | How Kubernetes Works.gif | 2025-02-17 07:24 | 769K | |
![[IMG]](/icons/image2.gif) | Top 4 Most Used Auth Mechanisms.png | 2023-08-14 09:22 | 765K | |
![[IMG]](/icons/image2.gif) | The Ultimate API Learning Roadmap.jpg | 2025-01-22 10:10 | 746K | |
![[IMG]](/icons/image2.gif) | 10 Key Data Structures We Use Every Day.gif | 2024-10-27 13:34 | 725K | |
![[IMG]](/icons/image2.gif) | Cheat Sheet for Designing Secure Systems.jpg | 2024-04-18 08:44 | 722K | |
![[IMG]](/icons/image2.gif) | DB Sharding.jpg | 2024-09-25 11:42 | 698K | |
![[IMG]](/icons/image2.gif) | What is OAuth.png | 2024-10-31 20:32 | 684K | |
![[IMG]](/icons/image2.gif) | API Pagination 101.jpg | 2025-02-10 08:05 | 683K | |
![[IMG]](/icons/image2.gif) | How To Release A Mobile App.jpg | 2024-12-10 08:25 | 650K | |
![[IMG]](/icons/image2.gif) | What is SOLID Principle.jpg | 2025-08-08 17:46 | 643K | |
![[IMG]](/icons/image2.gif) | De Software Development Ijsberg.jpg | 2025-06-06 10:52 | 641K | |
![[IMG]](/icons/image2.gif) | Cloud Database Cheat Sheet.jpg | 2023-08-16 08:59 | 608K | |
![[IMG]](/icons/image2.gif) | Program vs Process vs Thread.gif | 2025-04-22 06:46 | 602K | |
![[IMG]](/icons/image2.gif) | Explaining 9 types of API testing.jpg | 2024-01-31 09:20 | 597K | |
![[IMG]](/icons/image2.gif) | A Cheatsheet On Database Performance.jpg | 2025-02-10 08:06 | 590K | |
![[IMG]](/icons/image2.gif) | Best Practices in API Design.jpg | 2025-08-15 07:52 | 589K | |
![[IMG]](/icons/image2.gif) | Frontend Performance Cheatsheet.jpg | 2025-01-22 10:10 | 580K | |
![[IMG]](/icons/image2.gif) | Agile Stappen.jpg | 2025-02-12 11:47 | 574K | |
![[IMG]](/icons/image2.gif) | API sec.jpg | 2023-11-04 21:04 | 574K | |
![[IMG]](/icons/image2.gif) | A Walkthrough of the GenAI Landscape.jpg | 2025-01-07 06:07 | 567K | |
![[IMG]](/icons/image2.gif) | 10 Good Coding Principles.jpg | 2024-02-02 10:09 | 560K | |
![[IMG]](/icons/image2.gif) | 9 Types of Database Locks.jpg | 2024-07-24 12:22 | 559K | |
![[IMG]](/icons/image2.gif) | API Protocols.jpg | 2025-03-10 06:53 | 556K | |
![[IMG]](/icons/image2.gif) | Software Development Lifecycle.jpg | 2024-01-19 10:06 | 551K | |
![[IMG]](/icons/image2.gif) | AWS - Which Database Should I Use.jpg | 2025-03-06 07:22 | 547K | |
![[IMG]](/icons/image2.gif) | 9 Clean Code Tips To Keep In Mind.jpg | 2025-05-06 12:34 | 545K | |
![[IMG]](/icons/image2.gif) | Top 4 Most Used Authentication Mechanisms.jpg | 2025-03-03 07:06 | 545K | |
![[IMG]](/icons/image2.gif) | OAuth 2.0.jpg | 2023-08-29 06:32 | 533K | |
![[IMG]](/icons/image2.gif) | How does gRPC Work 2.jpg | 2024-12-30 09:24 | 529K | |
![[IMG]](/icons/image2.gif) | How HTTPS Works.jpg | 2023-08-16 18:46 | 529K | |
![[IMG]](/icons/image2.gif) | Cloud Security.jpg | 2025-02-10 08:04 | 526K | |
![[IMG]](/icons/image2.gif) | A Cheatsheet on API Gateways.png | 2024-10-12 11:00 | 522K | |
![[IMG]](/icons/image2.gif) | How is Data Transmitted between Apps.jpg | 2023-09-06 10:49 | 521K | |
![[IMG]](/icons/image2.gif) | CI CD Workflow.jpg | 2023-12-26 12:05 | 518K | |
![[IMG]](/icons/image2.gif) | Load Balancing Algorithms.jpg | 2025-03-10 06:54 | 515K | |
![[IMG]](/icons/image2.gif) | Life is Short, Use Dev Tools.jpg | 2025-01-22 10:08 | 514K | |
![[IMG]](/icons/image2.gif) | 8 Popular Network Protocols.jpg | 2024-03-23 11:12 | 509K | |
![[IMG]](/icons/image2.gif) | A Cheatsheet On Kubernetes.png | 2025-01-13 08:46 | 509K | |
![[IMG]](/icons/image2.gif) | Top 20 System Design Concepts Every Developer Should Know.jpg | 2025-04-24 05:36 | 509K | |
![[IMG]](/icons/image2.gif) | A Cheatsheet on Comparing API Architectural Styles.gif | 2024-10-27 13:33 | 507K | |
![[IMG]](/icons/image2.gif) | How do we adopt Cloud Native.jpg | 2024-03-23 11:11 | 504K | |
![[IMG]](/icons/image2.gif) | 12 Algorithms for System Design Interviews.jpg | 2025-02-11 13:58 | 503K | |
![[IMG]](/icons/image2.gif) | Best Ways To Test System Funcitonality.jpg | 2024-01-02 08:37 | 502K | |
![[IMG]](/icons/image2.gif) | Top 9 HTTP Request Methods.jpg | 2024-04-29 07:41 | 502K | |
![[IMG]](/icons/image2.gif) | Software Architecture Patterns.jpg | 2024-09-26 15:58 | 501K | |
![[IMG]](/icons/image2.gif) | How to Learn Backend Development.jpg | 2025-04-01 06:01 | 497K | |
![[IMG]](/icons/image2.gif) | Cloud Load Balancer CheatSheet.jpg | 2025-02-05 08:18 | 495K | |
![[IMG]](/icons/image2.gif) | Top 4 Types SQL Joins.jpg | 2023-12-13 09:08 | 493K | |
![[IMG]](/icons/image2.gif) | 9 Types API Testing.jpg | 2024-08-19 13:02 | 491K | |
![[IMG]](/icons/image2.gif) | API Security.jpg | 2023-10-30 17:43 | 489K | |
![[IMG]](/icons/image2.gif) | Top 20 System Design Concepts.jpg | 2025-10-23 09:27 | 482K | |
![[IMG]](/icons/image2.gif) | System Design Cheat Sheet.jpg | 2024-01-24 19:40 | 482K | |
![[IMG]](/icons/image2.gif) | Top Network Security.jpg | 2024-01-31 09:20 | 481K | |
![[IMG]](/icons/image2.gif) | What is Oauth.jpg | 2023-08-14 09:18 | 476K | |
![[IMG]](/icons/image2.gif) | Design Patterns Cheat Sheet.jpg | 2025-05-20 07:15 | 475K | |
![[IMG]](/icons/image2.gif) | Kubernetes Command Cheatsheet.jpg | 2024-12-19 08:41 | 475K | |
![[IMG]](/icons/image2.gif) | 12 Tips for API Security.jpg | 2024-03-02 11:35 | 475K | |
![[IMG]](/icons/image2.gif) | Logging, Tracing, Metrics.jpg | 2024-03-13 11:42 | 474K | |
![[IMG]](/icons/image2.gif) | POLLING Vs WEBHOOK.jpg | 2024-12-16 08:43 | 472K | |
![[IMG]](/icons/image2.gif) | Four Fundamental Pillars Of Object Oriented Programming.gif | 2025-04-29 05:36 | 470K | |
![[IMG]](/icons/image2.gif) | Cloud Security Cheat Sheet.jpg | 2024-02-06 08:13 | 470K | |
![[IMG]](/icons/image2.gif) | System Design Acronyms.jpg | 2023-11-15 15:51 | 469K | |
![[IMG]](/icons/image2.gif) | Microservice Best Practices.jpg | 2025-04-01 06:03 | 463K | |
![[IMG]](/icons/image2.gif) | What happens when you type a URL in the browser.jpg | 2023-10-09 18:49 | 461K | |
![[IMG]](/icons/image2.gif) | Orchestration vs Choreography Microservices.jpg | 2024-12-28 08:29 | 460K | |
![[IMG]](/icons/image2.gif) | Understanding Database Types.jpg | 2024-02-05 17:36 | 459K | |
![[IMG]](/icons/image2.gif) | How to Improve API Performance.jpg | 2023-12-26 12:05 | 447K | |
![[IMG]](/icons/image2.gif) | How Does SSO Work.jpg | 2025-08-15 07:52 | 447K | |
![[IMG]](/icons/image2.gif) | How to Learn SQL.jpg | 2025-02-24 07:35 | 447K | |
![[IMG]](/icons/image2.gif) | Software Architecture Styles.jpg | 2023-12-10 15:33 | 446K | |
![[IMG]](/icons/image2.gif) | What is OSI model.jpg | 2024-03-17 10:39 | 445K | |
![[IMG]](/icons/image2.gif) | Typical Architecture of a Web Application.jpg | 2025-01-21 08:36 | 443K | |
![[IMG]](/icons/image2.gif) | System Design Cheat Sheet v2.jpg | 2024-03-05 10:16 | 443K | |
![[IMG]](/icons/image2.gif) | Short, Long polling, SSE, WebSocket.jpg | 2025-02-10 08:04 | 443K | |
![[IMG]](/icons/image2.gif) | What is k8s.jpg | 2024-12-13 11:00 | 434K | |
![[IMG]](/icons/image2.gif) | API vs SDK.png | 2023-11-15 15:58 | 431K | |
![[IMG]](/icons/image2.gif) | How do CPP, Java, Python Work.jpg | 2024-03-05 10:17 | 431K | |
![[IMG]](/icons/image2.gif) | What is Semantic Versioning.gif | 2025-04-22 06:47 | 425K | |
![[IMG]](/icons/image2.gif) | How do Message Queues Evolve.jpg | 2024-03-02 11:36 | 425K | |
![[IMG]](/icons/image2.gif) | How does Docker Work.jpg | 2023-12-26 12:05 | 423K | |
![[IMG]](/icons/image2.gif) | How to stop stressing about tasks.jpg | 2024-01-10 17:05 | 421K | |
![[IMG]](/icons/image2.gif) | MVC,MVP,MVVM,VIPER patterns.jpg | 2023-11-27 16:28 | 421K | |
![[IMG]](/icons/image2.gif) | 4 K8S Service Types.jpg | 2023-12-28 11:30 | 418K | |
![[IMG]](/icons/image2.gif) | How SSH Works.jpg | 2025-02-24 07:35 | 413K | |
![[IMG]](/icons/image2.gif) | How Caches Can Go Wrong.jpg | 2024-03-07 10:34 | 412K | |
![[IMG]](/icons/image2.gif) | Linux File Permissions.jpg | 2024-03-23 11:12 | 411K | |
![[IMG]](/icons/image2.gif) | AI Tools.jpg | 2023-10-01 17:08 | 407K | |
![[IMG]](/icons/image2.gif) | Junior to Senior Developer Roadmap.jpg | 2024-09-09 09:11 | 405K | |
![[IMG]](/icons/image2.gif) | Docker explained.jpg | 2023-10-09 15:48 | 400K | |
![[IMG]](/icons/image2.gif) | Linux Performance Observability Tools.jpg | 2024-11-21 13:03 | 397K | |
![[IMG]](/icons/image2.gif) | What does ACID Mean.jpg | 2023-12-08 20:44 | 395K | |
![[IMG]](/icons/image2.gif) | Top 5 Caching Strategies.jpg | 2024-01-17 10:00 | 391K | |
![[IMG]](/icons/image2.gif) | Cloud DB cheatsheet.jpg | 2023-10-08 17:41 | 390K | |
![[IMG]](/icons/image2.gif) | Data Pipeline Overview.jpg | 2023-12-28 11:29 | 390K | |
![[IMG]](/icons/image2.gif) | Linux File Systems.jpg | 2024-01-09 16:36 | 373K | |
![[IMG]](/icons/image2.gif) | Session,JWT,Token,SSO,OAuth 2.0.jpg | 2023-11-22 11:22 | 368K | |
![[IMG]](/icons/image2.gif) | What is Cloud Native.jpg | 2025-01-06 08:12 | 364K | |
![[IMG]](/icons/image2.gif) | REST vs GraphQL.jpg | 2024-01-17 10:00 | 357K | |
![[IMG]](/icons/image2.gif) | Cache Systems Every Developer Should Know.jpg | 2023-11-22 11:22 | 356K | |
![[IMG]](/icons/image2.gif) | SQL Query Logical Order.jpg | 2025-01-06 08:12 | 356K | |
![[IMG]](/icons/image2.gif) | Git Commands Cheat Sheet.gif | 2025-04-29 05:36 | 352K | |
![[IMG]](/icons/image2.gif) | 8 Data Structures That Power Your Databases.jpg | 2024-04-15 08:37 | 345K | |
![[IMG]](/icons/image2.gif) | 12 Factor App.jpg | 2024-03-26 15:43 | 343K | |
![[IMG]](/icons/image2.gif) | System Design Blueprint - The Ultimate Guide.webp | 2024-02-24 12:07 | 338K | |
![[IMG]](/icons/image2.gif) | Internet Traffic Routing Policies.jpg | 2023-12-08 20:44 | 337K | |
![[IMG]](/icons/image2.gif) | Types of Databases.jpg | 2024-03-17 10:40 | 337K | |
![[IMG]](/icons/image2.gif) | Coupling and Cohesion In Software Architecture.jpg | 2025-04-29 05:51 | 336K | |
![[IMG]](/icons/image2.gif) | What is a Webhook.jpg | 2025-01-18 12:03 | 323K | |
![[IMG]](/icons/image2.gif) | HTTP Status Codes.jpg | 2025-01-06 08:14 | 320K | |
![[IMG]](/icons/image2.gif) | Linux Boot Process Explained.jpg | 2024-02-21 09:43 | 319K | |
![[IMG]](/icons/image2.gif) | How does Git Work.jpg | 2025-03-05 09:13 | 316K | |
![[IMG]](/icons/image2.gif) | REST API Design.jpg | 2024-03-20 10:09 | 312K | |
![[IMG]](/icons/image2.gif) | Design Effective & Safe APIs.jpg | 2024-01-12 10:18 | 308K | |
![[IMG]](/icons/image2.gif) | Forward Proxy v.s. Reverse Proxy.jpg | 2023-11-01 16:35 | 303K | |
![[IMG]](/icons/image2.gif) | Design a Shopping Cart.jpg | 2024-07-24 12:21 | 301K | |
![[IMG]](/icons/image2.gif) | Message Brokers 101.jpg | 2026-01-09 10:07 | 299K | |
![[IMG]](/icons/image2.gif) | REST API Cheatsheet.jpg | 2024-01-12 10:20 | 297K | |
![[IMG]](/icons/image2.gif) | How does gRPC Work.jpg | 2024-03-23 11:12 | 290K | |
![[IMG]](/icons/image2.gif) | On Premises vs IaaS vs PaaS vs SaaS.png | 2025-05-26 08:16 | 287K | |
![[IMG]](/icons/image2.gif) | 5 Data Structures Powering Database Indexes.jpg | 2025-07-18 10:30 | 276K | |
![[IMG]](/icons/image2.gif) | Polling, SSE, WebSocket.jpg | 2024-02-17 13:06 | 275K | |
![[IMG]](/icons/image2.gif) | Information about Caching.jpg | 2025-02-10 08:04 | 261K | |
![[IMG]](/icons/image2.gif) | Git Merge vs. Git Rebase.jpg | 2024-01-31 09:20 | 254K | |
![[IMG]](/icons/image2.gif) | API Architecture Styles.jpg | 2025-01-06 08:14 | 251K | |
![[IMG]](/icons/image2.gif) | Session, cookie, JWT, token, SSO, OAuth 2.0.jpg | 2025-08-10 11:47 | 248K | |
![[IMG]](/icons/image2.gif) | Awareness-understanding matrix.jpg | 2024-11-11 08:11 | 239K | |
![[IMG]](/icons/image2.gif) | URL vs URI vs URN.jpg | 2023-08-29 06:32 | 234K | |
![[IMG]](/icons/image2.gif) | System Design Blueprint - The Ultimate Guide 2.jpg | 2025-01-18 12:04 | 228K | |
![[IMG]](/icons/image2.gif) | Load Balancer vs. API Gateway.jpg | 2024-01-19 10:05 | 212K | |
![[IMG]](/icons/image2.gif) | Why is Redis so fast.jpg | 2025-01-22 10:10 | 208K | |
![[IMG]](/icons/image2.gif) | Top caching strategies.jpg | 2024-02-14 09:13 | 202K | |
![[IMG]](/icons/image2.gif) | A Cheatsheet On OOP Design Patterns.jpg | 2025-04-14 06:18 | 196K | |
![[IMG]](/icons/image2.gif) | A Cheatsheet On Domain-Drive Design.jpg | 2025-04-29 05:52 | 186K | |
![[IMG]](/icons/image2.gif) | Must-Know Message Broker Patterns.jpg | 2026-01-09 10:07 | 175K | |
![[IMG]](/icons/image2.gif) | How Git Commands work.jpg | 2024-01-24 19:40 | 171K | |
![[IMG]](/icons/image2.gif) | REST API Design - Best Practices.jpg | 2025-04-14 06:18 | 170K | |
![[IMG]](/icons/image2.gif) | Types of Message Queues.jpg | 2023-09-17 09:11 | 161K | |
![[IMG]](/icons/image2.gif) | PC Ports.jpg | 2024-10-07 11:38 | 145K | |
![[IMG]](/icons/image2.gif) | Top Redis Use Cases.jpg | 2024-02-06 08:13 | 140K | |
![[IMG]](/icons/image2.gif) | Docker Vs Kubernetes.jpg | 2025-01-06 08:13 | 121K | |
![[IMG]](/icons/image2.gif) | Latency Numbers You Should Know.jpg | 2024-01-31 09:20 | 106K | |
![[IMG]](/icons/image2.gif) | Zero Truse Security Cheatsheet.jpg | 2024-10-07 11:49 | 104K | |
![[IMG]](/icons/image2.gif) | Hard Decisions 4 Easy Life.jpg | 2024-02-02 10:05 | 100K | |
![[IMG]](/icons/image2.gif) | Structure of URL.jpg | 2025-01-18 12:02 | 97K | |
![[IMG]](/icons/image2.gif) | SQL JOINS Cheat Sheet.jpg | 2025-03-24 07:36 | 51K | |
![[ ]](/icons/unknown.gif) | What PWA Can Do Today.url | 2025-06-01 08:31 | 117 | |
|